C19H16N2O4 — CID 154729355
3-[(2,5-dimethylpyrazol-3-yl)methoxy]-8-hydroxybenzo[c]chromen-6-one (PubChem CID 154729355) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 3-[(2,5-dimethylpyrazol-3-yl)methoxy]-8-hydroxybenzo[c]chromen-6-one.
| Compound Name | 3-[(2,5-dimethylpyrazol-3-yl)methoxy]-8-hydroxybenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 154729355 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-[(2,5-dimethylpyrazol-3-yl)methoxy]-8-hydroxybenzo[c]chromen-6-one |
| SMILES | Cc1cc(COc2ccc3c(c2)oc(=O)c2cc(O)ccc23)n(C)n1 |
| InChI | InChI=1S/C19H16N2O4/c1-11-7-12(21(2)20-11)10-24-14-4-6-16-15-5-3-13(22)8-17(15)19(23)25-18(16)9-14/h3-9,22H,10H2,1-2H3 |
| InChIKey | KRRPMVVPWCPCTP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|