About 5,8-dibromo-1,2-bis(prop-2-enyl)-1H-isoquinoline
5,8-dibromo-1,2-bis(prop-2-enyl)-1H-isoquinoline (PubChem CID 15472975) has the molecular formula C15H15Br2N
and a molecular weight of 369.10 g/mol. Its IUPAC name is 5,8-dibromo-1,2-bis(prop-2-enyl)-1H-isoquinoline.
Molecular Properties
| Compound Name | 5,8-dibromo-1,2-bis(prop-2-enyl)-1H-isoquinoline |
| PubChem CID | 15472975 |
| Molecular Formula | C15H15Br2N |
| Molecular Weight | 369.10 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | 5,8-dibromo-1,2-bis(prop-2-enyl)-1H-isoquinoline |
| SMILES | C=CCC1c2c(Br)ccc(Br)c2C=CN1CC=C |
| InChI | InChI=1S/C15H15Br2N/c1-3-5-14-15-11(8-10-18(14)9-4-2)12(16)6-7-13(15)17/h3-4,6-8,10,14H,1-2,5,9H2 |
| InChIKey | HBQRVYNRUFXXKM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.10 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,8-dibromo-1,2-bis(prop-2-enyl)-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dibromo-1,2-bis(prop-2-enyl)-1H-isoquinoline?
The IUPAC name of 5,8-dibromo-1,2-bis(prop-2-enyl)-1H-isoquinoline (CID 15472975) is 5,8-dibromo-1,2-bis(prop-2-enyl)-1H-isoquinoline.
What is the SMILES notation for 5,8-dibromo-1,2-bis(prop-2-enyl)-1H-isoquinoline?
The canonical SMILES for 5,8-dibromo-1,2-bis(prop-2-enyl)-1H-isoquinoline is C=CCC1c2c(Br)ccc(Br)c2C=CN1CC=C.
What is the InChIKey of 5,8-dibromo-1,2-bis(prop-2-enyl)-1H-isoquinoline?
The InChIKey is HBQRVYNRUFXXKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15Br2N/c1-3-5-14-15-11(8-10-18(14)9-4-2)12(16)6-7-13(15)17/h3-4,6-8,10,14H,1-2,5,9H2.
What are the key properties of 5,8-dibromo-1,2-bis(prop-2-enyl)-1H-isoquinoline?
5,8-dibromo-1,2-bis(prop-2-enyl)-1H-isoquinoline has a molecular weight of 369.10 g/mol, XLogP of 5.30, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dibromo-1,2-bis(prop-2-enyl)-1H-isoquinoline is sourced from PubChem (CID 15472975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).