C21H24N3O+ — CID 154730291
(5R)-5-benzyl-2-(2,4,6-trimethylphenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium (PubChem CID 154730291) has the molecular formula C21H24N3O+ and a molecular weight of 334.44 g/mol. Its IUPAC name is (5R)-5-benzyl-2-(2,4,6-trimethylphenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium.
| Compound Name | (5R)-5-benzyl-2-(2,4,6-trimethylphenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium |
|---|---|
| PubChem CID | 154730291 |
| Molecular Formula | C21H24N3O+ |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (5R)-5-benzyl-2-(2,4,6-trimethylphenyl)-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium |
| SMILES | Cc1cc(C)c(-n2c[n+]3c(n2)COC[C@H]3Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C21H24N3O/c1-15-9-16(2)21(17(3)10-15)24-14-23-19(12-25-13-20(23)22-24)11-18-7-5-4-6-8-18/h4-10,14,19H,11-13H2,1-3H3/q+1/t19-/m1/s1 |
| InChIKey | PCBGTUWUTAYUMZ-LJQANCHMSA-N |
| XLogP | 3.40 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|