About 5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole chloride
5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole chloride (PubChem CID 154730534) has the molecular formula C14H16ClN2-
and a molecular weight of 247.75 g/mol. Its IUPAC name is 5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole chloride.
Molecular Properties
| Compound Name | 5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole chloride |
| PubChem CID | 154730534 |
| Molecular Formula | C14H16ClN2- |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole chloride |
| SMILES | CCC1(c2cnc[nH]2)Cc2ccccc2C1.[Cl-] |
| InChI | InChI=1S/C14H16N2.ClH/c1-2-14(13-9-15-10-16-13)7-11-5-3-4-6-12(11)8-14;/h3-6,9-10H,2,7-8H2,1H3,(H,15,16);1H/p-1 |
| InChIKey | PCCVCJAQMHDWJY-UHFFFAOYSA-M |
| XLogP | -0.14 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole chloride?
The IUPAC name of 5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole chloride (CID 154730534) is 5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole chloride.
What is the SMILES notation for 5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole chloride?
The canonical SMILES for 5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole chloride is CCC1(c2cnc[nH]2)Cc2ccccc2C1.[Cl-].
What is the InChIKey of 5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole chloride?
The InChIKey is PCCVCJAQMHDWJY-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H16N2.ClH/c1-2-14(13-9-15-10-16-13)7-11-5-3-4-6-12(11)8-14;/h3-6,9-10H,2,7-8H2,1H3,(H,15,16);1H/p-1.
What are the key properties of 5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole chloride?
5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole chloride has a molecular weight of 247.75 g/mol, XLogP of -0.14, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole chloride is sourced from PubChem (CID 154730534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).