C18H28N2O6 — CID 15473116
bis[(2S)-2-methylbutyl] 3,6-dioxo-2,5-diazabicyclo[2.2.2]octane-1,4-dicarboxylate (PubChem CID 15473116) has the molecular formula C18H28N2O6 and a molecular weight of 368.43 g/mol. Its IUPAC name is bis[(2S)-2-methylbutyl] 3,6-dioxo-2,5-diazabicyclo[2.2.2]octane-1,4-dicarboxylate.
| Compound Name | bis[(2S)-2-methylbutyl] 3,6-dioxo-2,5-diazabicyclo[2.2.2]octane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 15473116 |
| Molecular Formula | C18H28N2O6 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | bis[(2S)-2-methylbutyl] 3,6-dioxo-2,5-diazabicyclo[2.2.2]octane-1,4-dicarboxylate |
| SMILES | CC[C@H](C)COC(=O)C12CCC(C(=O)OC[C@@H](C)CC)(NC1=O)C(=O)N2 |
| InChI | InChI=1S/C18H28N2O6/c1-5-11(3)9-25-15(23)17-7-8-18(14(22)19-17,20-13(17)21)16(24)26-10-12(4)6-2/h11-12H,5-10H2,1-4H3,(H,19,22)(H,20,21)/t11-,12-,17?,18?/m0/s1 |
| InChIKey | HZYXVVJMRNDXEX-VCKYCXPWSA-N |
| XLogP | 0.68 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|