C10H9NO2 — CID 154731471
3-(2,3,4,5,6-pentadeuteriophenyl)pyrrolidine-2,5-dione (PubChem CID 154731471) has the molecular formula C10H9NO2 and a molecular weight of 180.22 g/mol. Its IUPAC name is 3-(2,3,4,5,6-pentadeuteriophenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(2,3,4,5,6-pentadeuteriophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 154731471 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 3-(2,3,4,5,6-pentadeuteriophenyl)pyrrolidine-2,5-dione |
| SMILES | [2H]c1c([2H])c([2H])c(C2CC(=O)NC2=O)c([2H])c1[2H] |
| InChI | InChI=1S/C10H9NO2/c12-9-6-8(10(13)11-9)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,11,12,13)/i1D,2D,3D,4D,5D |
| InChIKey | FVSWNQYFMNGPLF-RALIUCGRSA-N |
| XLogP | 0.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|