C33H66O4Si2 — CID 154731527
triethyl-[(2S,3R,6R)-3-ethyl-6-[(2S,4S,5S)-2-ethyl-5-[(E,1R)-1-ethyl-2-triethylsilyloxybut-2-enyl]-4-methyloxolan-2-yl]-2-methyloxan-3-yl]oxysilane (PubChem CID 154731527) has the molecular formula C33H66O4Si2 and a molecular weight of 583.06 g/mol. Its IUPAC name is triethyl-[(2S,3R,6R)-3-ethyl-6-[(2S,4S,5S)-2-ethyl-5-[(E,1R)-1-ethyl-2-triethylsilyloxybut-2-enyl]-4-methyloxolan-2-yl]-2-methyloxan-3-yl]oxysilane.
| Compound Name | triethyl-[(2S,3R,6R)-3-ethyl-6-[(2S,4S,5S)-2-ethyl-5-[(E,1R)-1-ethyl-2-triethylsilyloxybut-2-enyl]-4-methyloxolan-2-yl]-2-methyloxan-3-yl]oxysilane |
|---|---|
| PubChem CID | 154731527 |
| Molecular Formula | C33H66O4Si2 |
| Molecular Weight | 583.06 g/mol |
| Exact Mass | 582.45 |
| IUPAC Name | triethyl-[(2S,3R,6R)-3-ethyl-6-[(2S,4S,5S)-2-ethyl-5-[(E,1R)-1-ethyl-2-triethylsilyloxybut-2-enyl]-4-methyloxolan-2-yl]-2-methyloxan-3-yl]oxysilane |
| SMILES | C/C=C(/O[Si](CC)(CC)CC)[C@H](CC)[C@H]1O[C@](CC)([C@H]2CC[C@@](CC)(O[Si](CC)(CC)CC)[C@H](C)O2)C[C@@H]1C |
| InChI | InChI=1S/C33H66O4Si2/c1-13-28(29(14-2)36-38(17-5,18-6)19-7)31-26(11)25-33(16-4,35-31)30-23-24-32(15-3,27(12)34-30)37-39(20-8,21-9)22-10/h14,26-28,30-31H,13,15-25H2,1-12H3/b29-14+/t26-,27-,28-,30+,31-,32+,33-/m0/s1 |
| InChIKey | BGWCXKXFZCKZBD-HLWLFBBLSA-N |
| XLogP | 10.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.06 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|