C25H40O7 — CID 154731545
2-[(5S)-5-[(2R,5S)-5-[(2R,3S,5R)-5-[(2S,3S,5R)-3,5-dimethyl-6-oxooxan-2-yl]-3-methyloxolan-2-yl]-5-ethyloxolan-2-yl]-5-methyloxolan-2-yl]acetic acid (PubChem CID 154731545) has the molecular formula C25H40O7 and a molecular weight of 452.59 g/mol. Its IUPAC name is 2-[(5S)-5-[(2R,5S)-5-[(2R,3S,5R)-5-[(2S,3S,5R)-3,5-dimethyl-6-oxooxan-2-yl]-3-methyloxolan-2-yl]-5-ethyloxolan-2-yl]-5-methyloxolan-2-yl]acetic acid.
| Compound Name | 2-[(5S)-5-[(2R,5S)-5-[(2R,3S,5R)-5-[(2S,3S,5R)-3,5-dimethyl-6-oxooxan-2-yl]-3-methyloxolan-2-yl]-5-ethyloxolan-2-yl]-5-methyloxolan-2-yl]acetic acid |
|---|---|
| PubChem CID | 154731545 |
| Molecular Formula | C25H40O7 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 2-[(5S)-5-[(2R,5S)-5-[(2R,3S,5R)-5-[(2S,3S,5R)-3,5-dimethyl-6-oxooxan-2-yl]-3-methyloxolan-2-yl]-5-ethyloxolan-2-yl]-5-methyloxolan-2-yl]acetic acid |
| SMILES | CC[C@@]1([C@@H]2O[C@@H]([C@H]3OC(=O)[C@H](C)C[C@@H]3C)C[C@@H]2C)CC[C@H]([C@]2(C)CCC(CC(=O)O)O2)O1 |
| InChI | InChI=1S/C25H40O7/c1-6-25(10-8-19(32-25)24(5)9-7-17(31-24)13-20(26)27)22-15(3)12-18(29-22)21-14(2)11-16(4)23(28)30-21/h14-19,21-22H,6-13H2,1-5H3,(H,26,27)/t14-,15-,16+,17?,18+,19+,21-,22+,24-,25-/m0/s1 |
| InChIKey | PNUNYGCOOCGWRE-DIAQKGHKSA-N |
| XLogP | 4.11 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |