About 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol
2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol (PubChem CID 154732238) has the molecular formula C13H20Cl2N2O
and a molecular weight of 291.22 g/mol. Its IUPAC name is 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol.
Molecular Properties
| Compound Name | 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol |
| PubChem CID | 154732238 |
| Molecular Formula | C13H20Cl2N2O |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol |
| SMILES | CCC(C)(C)NC(CO)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C13H20Cl2N2O/c1-4-13(2,3)17-11(7-18)8-5-9(14)12(16)10(15)6-8/h5-6,11,17-18H,4,7,16H2,1-3H3 |
| InChIKey | ARSKROCCQDSZNG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol?
The IUPAC name of 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol (CID 154732238) is 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol.
What is the SMILES notation for 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol?
The canonical SMILES for 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol is CCC(C)(C)NC(CO)c1cc(Cl)c(N)c(Cl)c1.
What is the InChIKey of 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol?
The InChIKey is ARSKROCCQDSZNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20Cl2N2O/c1-4-13(2,3)17-11(7-18)8-5-9(14)12(16)10(15)6-8/h5-6,11,17-18H,4,7,16H2,1-3H3.
What are the key properties of 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol?
2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol has a molecular weight of 291.22 g/mol, XLogP of 3.39, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol is sourced from PubChem (CID 154732238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).