About 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride
2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride (PubChem CID 154732256) has the molecular formula C13H21Cl3N2O
and a molecular weight of 327.68 g/mol. Its IUPAC name is 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride.
Molecular Properties
| Compound Name | 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride |
| PubChem CID | 154732256 |
| Molecular Formula | C13H21Cl3N2O |
| Molecular Weight | 327.68 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride |
| SMILES | CCC(C)(C)NC(CO)c1cc(Cl)c(N)c(Cl)c1.Cl |
| InChI | InChI=1S/C13H20Cl2N2O.ClH/c1-4-13(2,3)17-11(7-18)8-5-9(14)12(16)10(15)6-8;/h5-6,11,17-18H,4,7,16H2,1-3H3;1H |
| InChIKey | PGWULAASRKHBNV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.68 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride?
The IUPAC name of 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride (CID 154732256) is 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride.
What is the SMILES notation for 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride?
The canonical SMILES for 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride is CCC(C)(C)NC(CO)c1cc(Cl)c(N)c(Cl)c1.Cl.
What is the InChIKey of 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride?
The InChIKey is PGWULAASRKHBNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20Cl2N2O.ClH/c1-4-13(2,3)17-11(7-18)8-5-9(14)12(16)10(15)6-8;/h5-6,11,17-18H,4,7,16H2,1-3H3;1H.
What are the key properties of 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride?
2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride has a molecular weight of 327.68 g/mol, XLogP of 3.81, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride is sourced from PubChem (CID 154732256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).