C15H19BO3 — CID 154732260
[6-(2,2-dimethylpropoxy)naphthalen-2-yl]boronic acid (PubChem CID 154732260) has the molecular formula C15H19BO3 and a molecular weight of 258.13 g/mol. Its IUPAC name is [6-(2,2-dimethylpropoxy)naphthalen-2-yl]boronic acid.
| Compound Name | [6-(2,2-dimethylpropoxy)naphthalen-2-yl]boronic acid |
|---|---|
| PubChem CID | 154732260 |
| Molecular Formula | C15H19BO3 |
| Molecular Weight | 258.13 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | [6-(2,2-dimethylpropoxy)naphthalen-2-yl]boronic acid |
| SMILES | CC(C)(C)COc1ccc2cc(B(O)O)ccc2c1 |
| InChI | InChI=1S/C15H19BO3/c1-15(2,3)10-19-14-7-5-11-8-13(16(17)18)6-4-12(11)9-14/h4-9,17-18H,10H2,1-3H3 |
| InChIKey | ONVLVDJUIHKUSF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.13 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|