C14H18N6 — CID 154732267
1-[3-(1,2,4-triazol-1-yl)-1-adamantyl]-1,2,4-triazole (PubChem CID 154732267) has the molecular formula C14H18N6 and a molecular weight of 270.34 g/mol. Its IUPAC name is 1-[3-(1,2,4-triazol-1-yl)-1-adamantyl]-1,2,4-triazole.
| Compound Name | 1-[3-(1,2,4-triazol-1-yl)-1-adamantyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 154732267 |
| Molecular Formula | C14H18N6 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-[3-(1,2,4-triazol-1-yl)-1-adamantyl]-1,2,4-triazole |
| SMILES | c1ncn(C23CC4CC(C2)CC(n2cncn2)(C4)C3)n1 |
| InChI | InChI=1S/C14H18N6/c1-11-2-13(19-9-15-7-17-19)4-12(1)5-14(3-11,6-13)20-10-16-8-18-20/h7-12H,1-6H2 |
| InChIKey | CHTMAGNEPXDNPD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |