C23H33NO — CID 154732557
(3S)-1-cyclohexyl-3-ethyl-3-[(E)-5-phenylpent-1-enyl]pyrrolidin-2-one (PubChem CID 154732557) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is (3S)-1-cyclohexyl-3-ethyl-3-[(E)-5-phenylpent-1-enyl]pyrrolidin-2-one.
| Compound Name | (3S)-1-cyclohexyl-3-ethyl-3-[(E)-5-phenylpent-1-enyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 154732557 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | (3S)-1-cyclohexyl-3-ethyl-3-[(E)-5-phenylpent-1-enyl]pyrrolidin-2-one |
| SMILES | CC[C@@]1(/C=C/CCCc2ccccc2)CCN(C2CCCCC2)C1=O |
| InChI | InChI=1S/C23H33NO/c1-2-23(17-11-5-8-14-20-12-6-3-7-13-20)18-19-24(22(23)25)21-15-9-4-10-16-21/h3,6-7,11-13,17,21H,2,4-5,8-10,14-16,18-19H2,1H3/b17-11+/t23-/m1/s1 |
| InChIKey | NPOCTDWZFDODJB-XMQQHFNTSA-N |
| XLogP | 5.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|