C24H28N4O3 — CID 154732617
N-[[4-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]methyl]propan-1-amine (PubChem CID 154732617) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is N-[[4-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[4-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 154732617 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | N-[[4-[5-(3,4-diethoxyphenyl)-1,2,4-oxadiazol-3-yl]-1H-indol-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1c[nH]c2cccc(-c3noc(-c4ccc(OCC)c(OCC)c4)n3)c12 |
| InChI | InChI=1S/C24H28N4O3/c1-4-12-25-14-17-15-26-19-9-7-8-18(22(17)19)23-27-24(31-28-23)16-10-11-20(29-5-2)21(13-16)30-6-3/h7-11,13,15,25-26H,4-6,12,14H2,1-3H3 |
| InChIKey | OYNAQRAKFPPFPF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|