C32H38N4O5 — CID 154732801
(3S)-N-benzyl-3-[[(2S)-3-cyclopentyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide (PubChem CID 154732801) has the molecular formula C32H38N4O5 and a molecular weight of 558.68 g/mol. Its IUPAC name is (3S)-N-benzyl-3-[[(2S)-3-cyclopentyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide.
| Compound Name | (3S)-N-benzyl-3-[[(2S)-3-cyclopentyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 154732801 |
| Molecular Formula | C32H38N4O5 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | (3S)-N-benzyl-3-[[(2S)-3-cyclopentyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-2-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butanamide |
| SMILES | O=C(/C=C/c1ccccc1)N[C@@H](CC1CCCC1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C32H38N4O5/c37-28(16-15-22-9-3-1-4-10-22)35-27(19-23-11-7-8-12-23)31(40)36-26(20-25-17-18-33-30(25)39)29(38)32(41)34-21-24-13-5-2-6-14-24/h1-6,9-10,13-16,23,25-27H,7-8,11-12,17-21H2,(H,33,39)(H,34,41)(H,35,37)(H,36,40)/b16-15+/t25-,26-,27-/m0/s1 |
| InChIKey | WKUXHSLNRCEEER-XBVLGBTFSA-N |
| XLogP | 2.66 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|