C14H20N6O8S — CID 154732873
[(2R,4S,5R)-3,4-dihydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)oxolan-2-yl]methyl N-butanoylsulfamate (PubChem CID 154732873) has the molecular formula C14H20N6O8S and a molecular weight of 432.42 g/mol. Its IUPAC name is [(2R,4S,5R)-3,4-dihydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)oxolan-2-yl]methyl N-butanoylsulfamate.
| Compound Name | [(2R,4S,5R)-3,4-dihydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)oxolan-2-yl]methyl N-butanoylsulfamate |
|---|---|
| PubChem CID | 154732873 |
| Molecular Formula | C14H20N6O8S |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | [(2R,4S,5R)-3,4-dihydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)oxolan-2-yl]methyl N-butanoylsulfamate |
| SMILES | [H]/N=C1/N=C2C(N=CN2[C@@H]2O[C@H](COS(=O)(=O)NC(=O)CCC)C(O)[C@@H]2O)C(=O)N1 |
| InChI | InChI=1S/C14H20N6O8S/c1-2-3-7(21)19-29(25,26)27-4-6-9(22)10(23)13(28-6)20-5-16-8-11(20)17-14(15)18-12(8)24/h5-6,8-10,13,22-23H,2-4H2,1H3,(H,19,21)(H2,15,18,24)/t6-,8?,9?,10+,13-/m1/s1 |
| InChIKey | NUTDCOXUZSAOFJ-IUXBQDNDSA-N |
| XLogP | -3.21 |
| TPSA | 203.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|