C17H11NO — CID 154733107
3-anthracen-9-yl-1,2-oxazole (PubChem CID 154733107) has the molecular formula C17H11NO and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-anthracen-9-yl-1,2-oxazole.
| Compound Name | 3-anthracen-9-yl-1,2-oxazole |
|---|---|
| PubChem CID | 154733107 |
| Molecular Formula | C17H11NO |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 3-anthracen-9-yl-1,2-oxazole |
| SMILES | c1ccc2c(-c3ccon3)c3ccccc3cc2c1 |
| InChI | InChI=1S/C17H11NO/c1-3-7-14-12(5-1)11-13-6-2-4-8-15(13)17(14)16-9-10-19-18-16/h1-11H |
| InChIKey | SMULQCBBZMLSTB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|