About diethyl (Z)-2-(2,3-dihydro-1,4-thiaselenin-2-ylsulfanyl)but-2-enedioate
diethyl (Z)-2-(2,3-dihydro-1,4-thiaselenin-2-ylsulfanyl)but-2-enedioate (PubChem CID 154733116) has the molecular formula C12H16O4S2Se
and a molecular weight of 367.35 g/mol. Its IUPAC name is diethyl (Z)-2-(2,3-dihydro-1,4-thiaselenin-2-ylsulfanyl)but-2-enedioate.
Molecular Properties
| Compound Name | diethyl (Z)-2-(2,3-dihydro-1,4-thiaselenin-2-ylsulfanyl)but-2-enedioate |
| PubChem CID | 154733116 |
| Molecular Formula | C12H16O4S2Se |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | diethyl (Z)-2-(2,3-dihydro-1,4-thiaselenin-2-ylsulfanyl)but-2-enedioate |
| SMILES | CCOC(=O)/C=C(\SC1C[Se]C=CS1)C(=O)OCC |
| InChI | InChI=1S/C12H16O4S2Se/c1-3-15-10(13)7-9(12(14)16-4-2)18-11-8-19-6-5-17-11/h5-7,11H,3-4,8H2,1-2H3/b9-7- |
| InChIKey | QZHABAIGDJZGTB-CLFYSBASSA-N |
| XLogP | 2.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl (Z)-2-(2,3-dihydro-1,4-thiaselenin-2-ylsulfanyl)but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (Z)-2-(2,3-dihydro-1,4-thiaselenin-2-ylsulfanyl)but-2-enedioate?
The IUPAC name of diethyl (Z)-2-(2,3-dihydro-1,4-thiaselenin-2-ylsulfanyl)but-2-enedioate (CID 154733116) is diethyl (Z)-2-(2,3-dihydro-1,4-thiaselenin-2-ylsulfanyl)but-2-enedioate.
What is the SMILES notation for diethyl (Z)-2-(2,3-dihydro-1,4-thiaselenin-2-ylsulfanyl)but-2-enedioate?
The canonical SMILES for diethyl (Z)-2-(2,3-dihydro-1,4-thiaselenin-2-ylsulfanyl)but-2-enedioate is CCOC(=O)/C=C(\SC1C[Se]C=CS1)C(=O)OCC.
What is the InChIKey of diethyl (Z)-2-(2,3-dihydro-1,4-thiaselenin-2-ylsulfanyl)but-2-enedioate?
The InChIKey is QZHABAIGDJZGTB-CLFYSBASSA-N. The full InChI is InChI=1S/C12H16O4S2Se/c1-3-15-10(13)7-9(12(14)16-4-2)18-11-8-19-6-5-17-11/h5-7,11H,3-4,8H2,1-2H3/b9-7-.
What are the key properties of diethyl (Z)-2-(2,3-dihydro-1,4-thiaselenin-2-ylsulfanyl)but-2-enedioate?
diethyl (Z)-2-(2,3-dihydro-1,4-thiaselenin-2-ylsulfanyl)but-2-enedioate has a molecular weight of 367.35 g/mol, XLogP of 2.40, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (Z)-2-(2,3-dihydro-1,4-thiaselenin-2-ylsulfanyl)but-2-enedioate is sourced from PubChem (CID 154733116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).