C12H16O2 — CID 15473347
3,4,5a,6,7,8,9,9a-octahydro-2H-dibenzofuran-1-one (PubChem CID 15473347) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 3,4,5a,6,7,8,9,9a-octahydro-2H-dibenzofuran-1-one.
| Compound Name | 3,4,5a,6,7,8,9,9a-octahydro-2H-dibenzofuran-1-one |
|---|---|
| PubChem CID | 15473347 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 3,4,5a,6,7,8,9,9a-octahydro-2H-dibenzofuran-1-one |
| SMILES | O=C1CCCC2=C1C1CCCCC1O2 |
| InChI | InChI=1S/C12H16O2/c13-9-5-3-7-11-12(9)8-4-1-2-6-10(8)14-11/h8,10H,1-7H2 |
| InChIKey | HIZIRXUBSWBAEY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |