C18H36N6O6 — CID 154733671
bis((2R,6S)-2,6-dimethyl-4-nitrosomorpholine);(2R,6R)-2,6-dimethyl-4-nitrosomorpholine (PubChem CID 154733671) has the molecular formula C18H36N6O6 and a molecular weight of 432.52 g/mol. Its IUPAC name is bis((2R,6S)-2,6-dimethyl-4-nitrosomorpholine);(2R,6R)-2,6-dimethyl-4-nitrosomorpholine.
| Compound Name | bis((2R,6S)-2,6-dimethyl-4-nitrosomorpholine);(2R,6R)-2,6-dimethyl-4-nitrosomorpholine |
|---|---|
| PubChem CID | 154733671 |
| Molecular Formula | C18H36N6O6 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | bis((2R,6S)-2,6-dimethyl-4-nitrosomorpholine);(2R,6R)-2,6-dimethyl-4-nitrosomorpholine |
| SMILES | C[C@@H]1CN(N=O)C[C@@H](C)O1.C[C@@H]1CN(N=O)C[C@H](C)O1.C[C@@H]1CN(N=O)C[C@H](C)O1 |
| InChI | InChI=1S/3C6H12N2O2/c3*1-5-3-8(7-9)4-6(2)10-5/h3*5-6H,3-4H2,1-2H3/t2*5-,6+;5-,6-/m..1/s1 |
| InChIKey | JYIBJQWYLQGIKZ-NMWJNNRQSA-N |
| XLogP | 2.33 |
| TPSA | 125.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|