About 2-[(2-chloro-6-iodo-3-pyridinyl)oxy]-N,N-diethylethanamine
2-[(2-chloro-6-iodo-3-pyridinyl)oxy]-N,N-diethylethanamine (PubChem CID 154734283) has the molecular formula C11H16ClIN2O
and a molecular weight of 354.62 g/mol. Its IUPAC name is 2-[(2-chloro-6-iodo-3-pyridinyl)oxy]-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-[(2-chloro-6-iodo-3-pyridinyl)oxy]-N,N-diethylethanamine |
| PubChem CID | 154734283 |
| Molecular Formula | C11H16ClIN2O |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 2-[(2-chloro-6-iodo-3-pyridinyl)oxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1ccc(I)nc1Cl |
| InChI | InChI=1S/C11H16ClIN2O/c1-3-15(4-2)7-8-16-9-5-6-10(13)14-11(9)12/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | BTWSRQYPUXWYPO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-chloro-6-iodo-3-pyridinyl)oxy]-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-chloro-6-iodo-3-pyridinyl)oxy]-N,N-diethylethanamine?
The IUPAC name of 2-[(2-chloro-6-iodo-3-pyridinyl)oxy]-N,N-diethylethanamine (CID 154734283) is 2-[(2-chloro-6-iodo-3-pyridinyl)oxy]-N,N-diethylethanamine.
What is the SMILES notation for 2-[(2-chloro-6-iodo-3-pyridinyl)oxy]-N,N-diethylethanamine?
The canonical SMILES for 2-[(2-chloro-6-iodo-3-pyridinyl)oxy]-N,N-diethylethanamine is CCN(CC)CCOc1ccc(I)nc1Cl.
What is the InChIKey of 2-[(2-chloro-6-iodo-3-pyridinyl)oxy]-N,N-diethylethanamine?
The InChIKey is BTWSRQYPUXWYPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16ClIN2O/c1-3-15(4-2)7-8-16-9-5-6-10(13)14-11(9)12/h5-6H,3-4,7-8H2,1-2H3.
What are the key properties of 2-[(2-chloro-6-iodo-3-pyridinyl)oxy]-N,N-diethylethanamine?
2-[(2-chloro-6-iodo-3-pyridinyl)oxy]-N,N-diethylethanamine has a molecular weight of 354.62 g/mol, XLogP of 3.06, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chloro-6-iodo-3-pyridinyl)oxy]-N,N-diethylethanamine is sourced from PubChem (CID 154734283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).