C5H7Cl6O4P — CID 154734502
2,2,2-trichloro-1-[methoxy(2,2,2-trichloroethoxy)phosphoryl]ethanol (PubChem CID 154734502) has the molecular formula C5H7Cl6O4P and a molecular weight of 374.80 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[methoxy(2,2,2-trichloroethoxy)phosphoryl]ethanol.
| Compound Name | 2,2,2-trichloro-1-[methoxy(2,2,2-trichloroethoxy)phosphoryl]ethanol |
|---|---|
| PubChem CID | 154734502 |
| Molecular Formula | C5H7Cl6O4P |
| Molecular Weight | 374.80 g/mol |
| Exact Mass | 371.82 |
| IUPAC Name | 2,2,2-trichloro-1-[methoxy(2,2,2-trichloroethoxy)phosphoryl]ethanol |
| SMILES | COP(=O)(OCC(Cl)(Cl)Cl)C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H7Cl6O4P/c1-14-16(13,3(12)5(9,10)11)15-2-4(6,7)8/h3,12H,2H2,1H3 |
| InChIKey | FEJRHUXKFLQUQP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.80 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|