About 2-(3-methyl-1,3-benzoxazol-2-ylidene)-N-phenylethanimine;hydroiodide
2-(3-methyl-1,3-benzoxazol-2-ylidene)-N-phenylethanimine;hydroiodide (PubChem CID 154735089) has the molecular formula C16H15IN2O
and a molecular weight of 378.21 g/mol. Its IUPAC name is 2-(3-methyl-1,3-benzoxazol-2-ylidene)-N-phenylethanimine;hydroiodide.
Molecular Properties
| Compound Name | 2-(3-methyl-1,3-benzoxazol-2-ylidene)-N-phenylethanimine;hydroiodide |
| PubChem CID | 154735089 |
| Molecular Formula | C16H15IN2O |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 2-(3-methyl-1,3-benzoxazol-2-ylidene)-N-phenylethanimine;hydroiodide |
| SMILES | CN1C(=C/C=N/c2ccccc2)Oc2ccccc21.I |
| InChI | InChI=1S/C16H14N2O.HI/c1-18-14-9-5-6-10-15(14)19-16(18)11-12-17-13-7-3-2-4-8-13;/h2-12H,1H3;1H/b16-11?,17-12+; |
| InChIKey | VNSBKPUDNWRFJU-FJYJEXKQSA-N |
| XLogP | 4.38 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methyl-1,3-benzoxazol-2-ylidene)-N-phenylethanimine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-1,3-benzoxazol-2-ylidene)-N-phenylethanimine;hydroiodide?
The IUPAC name of 2-(3-methyl-1,3-benzoxazol-2-ylidene)-N-phenylethanimine;hydroiodide (CID 154735089) is 2-(3-methyl-1,3-benzoxazol-2-ylidene)-N-phenylethanimine;hydroiodide.
What is the SMILES notation for 2-(3-methyl-1,3-benzoxazol-2-ylidene)-N-phenylethanimine;hydroiodide?
The canonical SMILES for 2-(3-methyl-1,3-benzoxazol-2-ylidene)-N-phenylethanimine;hydroiodide is CN1C(=C/C=N/c2ccccc2)Oc2ccccc21.I.
What is the InChIKey of 2-(3-methyl-1,3-benzoxazol-2-ylidene)-N-phenylethanimine;hydroiodide?
The InChIKey is VNSBKPUDNWRFJU-FJYJEXKQSA-N. The full InChI is InChI=1S/C16H14N2O.HI/c1-18-14-9-5-6-10-15(14)19-16(18)11-12-17-13-7-3-2-4-8-13;/h2-12H,1H3;1H/b16-11?,17-12+;.
What are the key properties of 2-(3-methyl-1,3-benzoxazol-2-ylidene)-N-phenylethanimine;hydroiodide?
2-(3-methyl-1,3-benzoxazol-2-ylidene)-N-phenylethanimine;hydroiodide has a molecular weight of 378.21 g/mol, XLogP of 4.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-1,3-benzoxazol-2-ylidene)-N-phenylethanimine;hydroiodide is sourced from PubChem (CID 154735089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).