C11H8Br4 — CID 154735127
(1R,8S,9S,10R)-1,9,10,11-tetrabromotricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 154735127) has the molecular formula C11H8Br4 and a molecular weight of 459.80 g/mol. Its IUPAC name is (1R,8S,9S,10R)-1,9,10,11-tetrabromotricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1R,8S,9S,10R)-1,9,10,11-tetrabromotricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 154735127 |
| Molecular Formula | C11H8Br4 |
| Molecular Weight | 459.80 g/mol |
| Exact Mass | 455.74 |
| IUPAC Name | (1R,8S,9S,10R)-1,9,10,11-tetrabromotricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | BrC1[C@H]2c3ccccc3[C@]1(Br)[C@H](Br)[C@H]2Br |
| InChI | InChI=1S/C11H8Br4/c12-8-7-5-3-1-2-4-6(5)11(15,9(7)13)10(8)14/h1-4,7-10H/t7-,8-,9?,10+,11+/m0/s1 |
| InChIKey | YQOLUCYVQSZPIT-XSCZHNOTSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.80 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|