C17H22N4O2 — CID 154737436
1-(4-methyloxan-4-yl)-3-(5-methyl-1-phenylpyrazol-3-yl)urea (PubChem CID 154737436) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-(4-methyloxan-4-yl)-3-(5-methyl-1-phenylpyrazol-3-yl)urea.
| Compound Name | 1-(4-methyloxan-4-yl)-3-(5-methyl-1-phenylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 154737436 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1-(4-methyloxan-4-yl)-3-(5-methyl-1-phenylpyrazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)NC2(C)CCOCC2)nn1-c1ccccc1 |
| InChI | InChI=1S/C17H22N4O2/c1-13-12-15(20-21(13)14-6-4-3-5-7-14)18-16(22)19-17(2)8-10-23-11-9-17/h3-7,12H,8-11H2,1-2H3,(H2,18,19,20,22) |
| InChIKey | YREOFNXYARQIRS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |