About N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methyl-2-oxo-1H-quinoxaline-6-sulfonamide
N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methyl-2-oxo-1H-quinoxaline-6-sulfonamide (PubChem CID 154738025) has the molecular formula C15H21N3O4S
and a molecular weight of 339.42 g/mol. Its IUPAC name is N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methyl-2-oxo-1H-quinoxaline-6-sulfonamide.
Molecular Properties
| Compound Name | N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methyl-2-oxo-1H-quinoxaline-6-sulfonamide |
| PubChem CID | 154738025 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methyl-2-oxo-1H-quinoxaline-6-sulfonamide |
| SMILES | CN(C(CO)C(C)(C)C)S(=O)(=O)c1ccc2[nH]c(=O)cnc2c1 |
| InChI | InChI=1S/C15H21N3O4S/c1-15(2,3)13(9-19)18(4)23(21,22)10-5-6-11-12(7-10)16-8-14(20)17-11/h5-8,13,19H,9H2,1-4H3,(H,17,20) |
| InChIKey | ZNMUKFBJYGAWKO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methyl-2-oxo-1H-quinoxaline-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methyl-2-oxo-1H-quinoxaline-6-sulfonamide?
The IUPAC name of N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methyl-2-oxo-1H-quinoxaline-6-sulfonamide (CID 154738025) is N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methyl-2-oxo-1H-quinoxaline-6-sulfonamide.
What is the SMILES notation for N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methyl-2-oxo-1H-quinoxaline-6-sulfonamide?
The canonical SMILES for N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methyl-2-oxo-1H-quinoxaline-6-sulfonamide is CN(C(CO)C(C)(C)C)S(=O)(=O)c1ccc2[nH]c(=O)cnc2c1.
What is the InChIKey of N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methyl-2-oxo-1H-quinoxaline-6-sulfonamide?
The InChIKey is ZNMUKFBJYGAWKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O4S/c1-15(2,3)13(9-19)18(4)23(21,22)10-5-6-11-12(7-10)16-8-14(20)17-11/h5-8,13,19H,9H2,1-4H3,(H,17,20).
What are the key properties of N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methyl-2-oxo-1H-quinoxaline-6-sulfonamide?
N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methyl-2-oxo-1H-quinoxaline-6-sulfonamide has a molecular weight of 339.42 g/mol, XLogP of 0.95, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methyl-2-oxo-1H-quinoxaline-6-sulfonamide is sourced from PubChem (CID 154738025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).