C12H12F3N3O2S — CID 154738187
2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione (PubChem CID 154738187) has the molecular formula C12H12F3N3O2S and a molecular weight of 319.31 g/mol. Its IUPAC name is 2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione.
| Compound Name | 2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
|---|---|
| PubChem CID | 154738187 |
| Molecular Formula | C12H12F3N3O2S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
| SMILES | O=C1C2CCCCN2C(=O)N1Cc1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C12H12F3N3O2S/c13-12(14,15)8-6-21-9(16-8)5-18-10(19)7-3-1-2-4-17(7)11(18)20/h6-7H,1-5H2 |
| InChIKey | HQHVUVLUJUDVTE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|