About 4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid
4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid (PubChem CID 154740273) has the molecular formula C18H22N2O6
and a molecular weight of 362.38 g/mol. Its IUPAC name is 4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid |
| PubChem CID | 154740273 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid |
| SMILES | O=C1CCc2cc(OCCCC(=O)N3CCOCC3C(=O)O)ccc2N1 |
| InChI | InChI=1S/C18H22N2O6/c21-16-6-3-12-10-13(4-5-14(12)19-16)26-8-1-2-17(22)20-7-9-25-11-15(20)18(23)24/h4-5,10,15H,1-3,6-9,11H2,(H,19,21)(H,23,24) |
| InChIKey | KAJGDVWRAIQHHI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid?
The IUPAC name of 4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid (CID 154740273) is 4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid.
What is the SMILES notation for 4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid?
The canonical SMILES for 4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid is O=C1CCc2cc(OCCCC(=O)N3CCOCC3C(=O)O)ccc2N1.
What is the InChIKey of 4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid?
The InChIKey is KAJGDVWRAIQHHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O6/c21-16-6-3-12-10-13(4-5-14(12)19-16)26-8-1-2-17(22)20-7-9-25-11-15(20)18(23)24/h4-5,10,15H,1-3,6-9,11H2,(H,19,21)(H,23,24).
What are the key properties of 4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid?
4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid has a molecular weight of 362.38 g/mol, XLogP of 1.04, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid is sourced from PubChem (CID 154740273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).