C18H22N2O6 — CID 154740273
4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid (PubChem CID 154740273) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is 4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid.
| Compound Name | 4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 154740273 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 4-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]morpholine-3-carboxylic acid |
| SMILES | O=C1CCc2cc(OCCCC(=O)N3CCOCC3C(=O)O)ccc2N1 |
| InChI | InChI=1S/C18H22N2O6/c21-16-6-3-12-10-13(4-5-14(12)19-16)26-8-1-2-17(22)20-7-9-25-11-15(20)18(23)24/h4-5,10,15H,1-3,6-9,11H2,(H,19,21)(H,23,24) |
| InChIKey | KAJGDVWRAIQHHI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|