About trans-(1R,2R)-2-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)cyclohexan-1-amine
trans-(1R,2R)-2-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)cyclohexan-1-amine (PubChem CID 15474043) has the molecular formula C20H24N2
and a molecular weight of 292.43 g/mol. Its IUPAC name is trans-(1R,2R)-2-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)cyclohexan-1-amine |
| PubChem CID | 15474043 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | trans-(1R,2R)-2-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)cyclohexan-1-amine |
| SMILES | N[C@@H]1CCCC[C@H]1N1Cc2ccccc2-c2ccccc2C1 |
| InChI | InChI=1S/C20H24N2/c21-19-11-5-6-12-20(19)22-13-15-7-1-3-9-17(15)18-10-4-2-8-16(18)14-22/h1-4,7-10,19-20H,5-6,11-14,21H2/t19-,20-/m1/s1 |
| InChIKey | MVGUMPYYPVQVAN-WOJBJXKFSA-N |
| XLogP | 3.94 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1R,2R)-2-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)cyclohexan-1-amine?
The IUPAC name of trans-(1R,2R)-2-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)cyclohexan-1-amine (CID 15474043) is trans-(1R,2R)-2-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)cyclohexan-1-amine.
What is the SMILES notation for trans-(1R,2R)-2-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)cyclohexan-1-amine?
The canonical SMILES for trans-(1R,2R)-2-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)cyclohexan-1-amine is N[C@@H]1CCCC[C@H]1N1Cc2ccccc2-c2ccccc2C1.
What is the InChIKey of trans-(1R,2R)-2-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)cyclohexan-1-amine?
The InChIKey is MVGUMPYYPVQVAN-WOJBJXKFSA-N. The full InChI is InChI=1S/C20H24N2/c21-19-11-5-6-12-20(19)22-13-15-7-1-3-9-17(15)18-10-4-2-8-16(18)14-22/h1-4,7-10,19-20H,5-6,11-14,21H2/t19-,20-/m1/s1.
What are the key properties of trans-(1R,2R)-2-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)cyclohexan-1-amine?
trans-(1R,2R)-2-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)cyclohexan-1-amine has a molecular weight of 292.43 g/mol, XLogP of 3.94, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-(5,7-dihydrobenzo[d][2]benzazepin-6-yl)cyclohexan-1-amine is sourced from PubChem (CID 15474043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).