C23H40N2O — CID 15474050
2,4-ditert-butyl-6-[[[(1R,2R)-2-(dimethylamino)cyclohexyl]amino]methyl]phenol (PubChem CID 15474050) has the molecular formula C23H40N2O and a molecular weight of 360.59 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[[(1R,2R)-2-(dimethylamino)cyclohexyl]amino]methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[[(1R,2R)-2-(dimethylamino)cyclohexyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 15474050 |
| Molecular Formula | C23H40N2O |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.31 |
| IUPAC Name | 2,4-ditert-butyl-6-[[[(1R,2R)-2-(dimethylamino)cyclohexyl]amino]methyl]phenol |
| SMILES | CN(C)[C@@H]1CCCC[C@H]1NCc1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H40N2O/c1-22(2,3)17-13-16(21(26)18(14-17)23(4,5)6)15-24-19-11-9-10-12-20(19)25(7)8/h13-14,19-20,24,26H,9-12,15H2,1-8H3/t19-,20-/m1/s1 |
| InChIKey | QGKYIZZZJSWPGZ-WOJBJXKFSA-N |
| XLogP | 4.95 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|