C18H24N2O — CID 154740554
(4aR,7aS)-6-methyl-1-(2-methyl-3-phenylprop-2-enyl)-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one (PubChem CID 154740554) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is (4aR,7aS)-6-methyl-1-(2-methyl-3-phenylprop-2-enyl)-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one.
| Compound Name | (4aR,7aS)-6-methyl-1-(2-methyl-3-phenylprop-2-enyl)-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 154740554 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | (4aR,7aS)-6-methyl-1-(2-methyl-3-phenylprop-2-enyl)-2,3,4,4a,7,7a-hexahydropyrrolo[3,4-b]pyridin-5-one |
| SMILES | CC(=Cc1ccccc1)CN1CCC[C@H]2C(=O)N(C)C[C@H]21 |
| InChI | InChI=1S/C18H24N2O/c1-14(11-15-7-4-3-5-8-15)12-20-10-6-9-16-17(20)13-19(2)18(16)21/h3-5,7-8,11,16-17H,6,9-10,12-13H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | ZNCWBXMOMCLRMM-IAGOWNOFSA-N |
| XLogP | 2.64 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |