C16H16N4O2 — CID 154740707
1-(2-phenoxyethyl)-5-prop-2-enylpyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 154740707) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 1-(2-phenoxyethyl)-5-prop-2-enylpyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-(2-phenoxyethyl)-5-prop-2-enylpyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 154740707 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-(2-phenoxyethyl)-5-prop-2-enylpyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | C=CCn1cnc2c(cnn2CCOc2ccccc2)c1=O |
| InChI | InChI=1S/C16H16N4O2/c1-2-8-19-12-17-15-14(16(19)21)11-18-20(15)9-10-22-13-6-4-3-5-7-13/h2-7,11-12H,1,8-10H2 |
| InChIKey | XDAUBEFVRVPNEX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|