About 3-[[(4,7-dimethylquinolin-2-yl)amino]methyl]piperidin-2-one
3-[[(4,7-dimethylquinolin-2-yl)amino]methyl]piperidin-2-one (PubChem CID 154741470) has the molecular formula C17H21N3O
and a molecular weight of 283.38 g/mol. Its IUPAC name is 3-[[(4,7-dimethylquinolin-2-yl)amino]methyl]piperidin-2-one.
Molecular Properties
| Compound Name | 3-[[(4,7-dimethylquinolin-2-yl)amino]methyl]piperidin-2-one |
| PubChem CID | 154741470 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3-[[(4,7-dimethylquinolin-2-yl)amino]methyl]piperidin-2-one |
| SMILES | Cc1ccc2c(C)cc(NCC3CCCNC3=O)nc2c1 |
| InChI | InChI=1S/C17H21N3O/c1-11-5-6-14-12(2)9-16(20-15(14)8-11)19-10-13-4-3-7-18-17(13)21/h5-6,8-9,13H,3-4,7,10H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | AROOEYQLBKKQOB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[(4,7-dimethylquinolin-2-yl)amino]methyl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(4,7-dimethylquinolin-2-yl)amino]methyl]piperidin-2-one?
The IUPAC name of 3-[[(4,7-dimethylquinolin-2-yl)amino]methyl]piperidin-2-one (CID 154741470) is 3-[[(4,7-dimethylquinolin-2-yl)amino]methyl]piperidin-2-one.
What is the SMILES notation for 3-[[(4,7-dimethylquinolin-2-yl)amino]methyl]piperidin-2-one?
The canonical SMILES for 3-[[(4,7-dimethylquinolin-2-yl)amino]methyl]piperidin-2-one is Cc1ccc2c(C)cc(NCC3CCCNC3=O)nc2c1.
What is the InChIKey of 3-[[(4,7-dimethylquinolin-2-yl)amino]methyl]piperidin-2-one?
The InChIKey is AROOEYQLBKKQOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O/c1-11-5-6-14-12(2)9-16(20-15(14)8-11)19-10-13-4-3-7-18-17(13)21/h5-6,8-9,13H,3-4,7,10H2,1-2H3,(H,18,21)(H,19,20).
What are the key properties of 3-[[(4,7-dimethylquinolin-2-yl)amino]methyl]piperidin-2-one?
3-[[(4,7-dimethylquinolin-2-yl)amino]methyl]piperidin-2-one has a molecular weight of 283.38 g/mol, XLogP of 2.79, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(4,7-dimethylquinolin-2-yl)amino]methyl]piperidin-2-one is sourced from PubChem (CID 154741470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).