C15H26N6O — CID 154741561
2-(methylamino)-1-[3-(3-piperazin-1-yl-1H-pyrazol-5-yl)piperidin-1-yl]ethanone (PubChem CID 154741561) has the molecular formula C15H26N6O and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-(methylamino)-1-[3-(3-piperazin-1-yl-1H-pyrazol-5-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-(methylamino)-1-[3-(3-piperazin-1-yl-1H-pyrazol-5-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 154741561 |
| Molecular Formula | C15H26N6O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 2-(methylamino)-1-[3-(3-piperazin-1-yl-1H-pyrazol-5-yl)piperidin-1-yl]ethanone |
| SMILES | CNCC(=O)N1CCCC(c2cc(N3CCNCC3)n[nH]2)C1 |
| InChI | InChI=1S/C15H26N6O/c1-16-10-15(22)21-6-2-3-12(11-21)13-9-14(19-18-13)20-7-4-17-5-8-20/h9,12,16-17H,2-8,10-11H2,1H3,(H,18,19) |
| InChIKey | HOIHODREWQIAPM-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |