About N-[[4-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]morpholin-3-yl]methyl]methanesulfonamide
N-[[4-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]morpholin-3-yl]methyl]methanesulfonamide (PubChem CID 154741632) has the molecular formula C15H21F3N2O3S
and a molecular weight of 366.41 g/mol. Its IUPAC name is N-[[4-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]morpholin-3-yl]methyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[[4-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]morpholin-3-yl]methyl]methanesulfonamide |
| PubChem CID | 154741632 |
| Molecular Formula | C15H21F3N2O3S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-[[4-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]morpholin-3-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC1COCCN1Cc1ccc(CC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H21F3N2O3S/c1-24(21,22)19-9-14-11-23-7-6-20(14)10-13-4-2-12(3-5-13)8-15(16,17)18/h2-5,14,19H,6-11H2,1H3 |
| InChIKey | JMYZWYYSLSEGFS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[4-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]morpholin-3-yl]methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]morpholin-3-yl]methyl]methanesulfonamide?
The IUPAC name of N-[[4-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]morpholin-3-yl]methyl]methanesulfonamide (CID 154741632) is N-[[4-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]morpholin-3-yl]methyl]methanesulfonamide.
What is the SMILES notation for N-[[4-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]morpholin-3-yl]methyl]methanesulfonamide?
The canonical SMILES for N-[[4-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]morpholin-3-yl]methyl]methanesulfonamide is CS(=O)(=O)NCC1COCCN1Cc1ccc(CC(F)(F)F)cc1.
What is the InChIKey of N-[[4-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]morpholin-3-yl]methyl]methanesulfonamide?
The InChIKey is JMYZWYYSLSEGFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F3N2O3S/c1-24(21,22)19-9-14-11-23-7-6-20(14)10-13-4-2-12(3-5-13)8-15(16,17)18/h2-5,14,19H,6-11H2,1H3.
What are the key properties of N-[[4-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]morpholin-3-yl]methyl]methanesulfonamide?
N-[[4-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]morpholin-3-yl]methyl]methanesulfonamide has a molecular weight of 366.41 g/mol, XLogP of 1.54, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]morpholin-3-yl]methyl]methanesulfonamide is sourced from PubChem (CID 154741632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).