C19H22N4O2 — CID 154742252
2-ethyl-7-(2-ethylquinolin-4-yl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 154742252) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-ethyl-7-(2-ethylquinolin-4-yl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | 2-ethyl-7-(2-ethylquinolin-4-yl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 154742252 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-ethyl-7-(2-ethylquinolin-4-yl)-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | CCc1cc(N2CCN3C(=O)N(CC)C(=O)C3C2)c2ccccc2n1 |
| InChI | InChI=1S/C19H22N4O2/c1-3-13-11-16(14-7-5-6-8-15(14)20-13)21-9-10-23-17(12-21)18(24)22(4-2)19(23)25/h5-8,11,17H,3-4,9-10,12H2,1-2H3 |
| InChIKey | OUSKHGCRDBYGAB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|