About [4,4-difluoro-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)pyrrolidin-2-yl]methanol
[4,4-difluoro-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)pyrrolidin-2-yl]methanol (PubChem CID 154742254) has the molecular formula C12H14F2N4O
and a molecular weight of 268.27 g/mol. Its IUPAC name is [4,4-difluoro-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [4,4-difluoro-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)pyrrolidin-2-yl]methanol |
| PubChem CID | 154742254 |
| Molecular Formula | C12H14F2N4O |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | [4,4-difluoro-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)pyrrolidin-2-yl]methanol |
| SMILES | OCC1CC(F)(F)CN1Cc1cn2cccnc2n1 |
| InChI | InChI=1S/C12H14F2N4O/c13-12(14)4-10(7-19)18(8-12)6-9-5-17-3-1-2-15-11(17)16-9/h1-3,5,10,19H,4,6-8H2 |
| InChIKey | VMIAZWWMMICHHA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4,4-difluoro-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4-difluoro-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)pyrrolidin-2-yl]methanol?
The IUPAC name of [4,4-difluoro-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)pyrrolidin-2-yl]methanol (CID 154742254) is [4,4-difluoro-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)pyrrolidin-2-yl]methanol.
What is the SMILES notation for [4,4-difluoro-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)pyrrolidin-2-yl]methanol?
The canonical SMILES for [4,4-difluoro-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)pyrrolidin-2-yl]methanol is OCC1CC(F)(F)CN1Cc1cn2cccnc2n1.
What is the InChIKey of [4,4-difluoro-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)pyrrolidin-2-yl]methanol?
The InChIKey is VMIAZWWMMICHHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2N4O/c13-12(14)4-10(7-19)18(8-12)6-9-5-17-3-1-2-15-11(17)16-9/h1-3,5,10,19H,4,6-8H2.
What are the key properties of [4,4-difluoro-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)pyrrolidin-2-yl]methanol?
[4,4-difluoro-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)pyrrolidin-2-yl]methanol has a molecular weight of 268.27 g/mol, XLogP of 0.93, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-difluoro-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)pyrrolidin-2-yl]methanol is sourced from PubChem (CID 154742254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).