C9H18FN3O — CID 154742284
N-(2-amino-3-methylbutyl)-3-fluoroazetidine-1-carboxamide (PubChem CID 154742284) has the molecular formula C9H18FN3O and a molecular weight of 203.26 g/mol. Its IUPAC name is N-(2-amino-3-methylbutyl)-3-fluoroazetidine-1-carboxamide.
| Compound Name | N-(2-amino-3-methylbutyl)-3-fluoroazetidine-1-carboxamide |
|---|---|
| PubChem CID | 154742284 |
| Molecular Formula | C9H18FN3O |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | N-(2-amino-3-methylbutyl)-3-fluoroazetidine-1-carboxamide |
| SMILES | CC(C)C(N)CNC(=O)N1CC(F)C1 |
| InChI | InChI=1S/C9H18FN3O/c1-6(2)8(11)3-12-9(14)13-4-7(10)5-13/h6-8H,3-5,11H2,1-2H3,(H,12,14) |
| InChIKey | HAFCDARSBXZFTJ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |