C16H23FN2O3 — CID 154743413
4-fluoro-2-(hydroxymethyl)-N-(4-hydroxy-1-phenylbutyl)pyrrolidine-1-carboxamide (PubChem CID 154743413) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is 4-fluoro-2-(hydroxymethyl)-N-(4-hydroxy-1-phenylbutyl)pyrrolidine-1-carboxamide.
| Compound Name | 4-fluoro-2-(hydroxymethyl)-N-(4-hydroxy-1-phenylbutyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 154743413 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 4-fluoro-2-(hydroxymethyl)-N-(4-hydroxy-1-phenylbutyl)pyrrolidine-1-carboxamide |
| SMILES | O=C(NC(CCCO)c1ccccc1)N1CC(F)CC1CO |
| InChI | InChI=1S/C16H23FN2O3/c17-13-9-14(11-21)19(10-13)16(22)18-15(7-4-8-20)12-5-2-1-3-6-12/h1-3,5-6,13-15,20-21H,4,7-11H2,(H,18,22) |
| InChIKey | VMOKSEFJOUDAID-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |