C9H10F6O3 — CID 15474451
1,1,1,3,3,3-hexafluoropropan-2-yl (3R)-3-hydroxy-2-methylidenepentanoate (PubChem CID 15474451) has the molecular formula C9H10F6O3 and a molecular weight of 280.16 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl (3R)-3-hydroxy-2-methylidenepentanoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (3R)-3-hydroxy-2-methylidenepentanoate |
|---|---|
| PubChem CID | 15474451 |
| Molecular Formula | C9H10F6O3 |
| Molecular Weight | 280.16 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (3R)-3-hydroxy-2-methylidenepentanoate |
| SMILES | C=C(C(=O)OC(C(F)(F)F)C(F)(F)F)[C@H](O)CC |
| InChI | InChI=1S/C9H10F6O3/c1-3-5(16)4(2)6(17)18-7(8(10,11)12)9(13,14)15/h5,7,16H,2-3H2,1H3/t5-/m1/s1 |
| InChIKey | UTMQMZUVVLJJST-RXMQYKEDSA-N |
| XLogP | 2.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.16 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|