C21H26OS — CID 15474462
1-[(1R,2S)-2-[(2E,4E)-5-phenylsulfanylpenta-2,4-dien-2-yl]cyclohexyl]but-3-en-2-one (PubChem CID 15474462) has the molecular formula C21H26OS and a molecular weight of 326.50 g/mol. Its IUPAC name is 1-[(1R,2S)-2-[(2E,4E)-5-phenylsulfanylpenta-2,4-dien-2-yl]cyclohexyl]but-3-en-2-one.
| Compound Name | 1-[(1R,2S)-2-[(2E,4E)-5-phenylsulfanylpenta-2,4-dien-2-yl]cyclohexyl]but-3-en-2-one |
|---|---|
| PubChem CID | 15474462 |
| Molecular Formula | C21H26OS |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-[(1R,2S)-2-[(2E,4E)-5-phenylsulfanylpenta-2,4-dien-2-yl]cyclohexyl]but-3-en-2-one |
| SMILES | C=CC(=O)C[C@H]1CCCC[C@@H]1/C(C)=C/C=C/Sc1ccccc1 |
| InChI | InChI=1S/C21H26OS/c1-3-19(22)16-18-11-7-8-14-21(18)17(2)10-9-15-23-20-12-5-4-6-13-20/h3-6,9-10,12-13,15,18,21H,1,7-8,11,14,16H2,2H3/b15-9+,17-10+/t18-,21-/m1/s1 |
| InChIKey | KMWDNHNYMJVFAF-QHCXHFECSA-N |
| XLogP | 6.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|