About 8-fluoro-2-methyl-4-[4-(trifluoromethyl)cyclohexyl]sulfonyl-2,3-dihydro-1,4-benzoxazine
8-fluoro-2-methyl-4-[4-(trifluoromethyl)cyclohexyl]sulfonyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 154744624) has the molecular formula C16H19F4NO3S
and a molecular weight of 381.39 g/mol. Its IUPAC name is 8-fluoro-2-methyl-4-[4-(trifluoromethyl)cyclohexyl]sulfonyl-2,3-dihydro-1,4-benzoxazine.
Molecular Properties
| Compound Name | 8-fluoro-2-methyl-4-[4-(trifluoromethyl)cyclohexyl]sulfonyl-2,3-dihydro-1,4-benzoxazine |
| PubChem CID | 154744624 |
| Molecular Formula | C16H19F4NO3S |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 8-fluoro-2-methyl-4-[4-(trifluoromethyl)cyclohexyl]sulfonyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | CC1CN(S(=O)(=O)C2CCC(C(F)(F)F)CC2)c2cccc(F)c2O1 |
| InChI | InChI=1S/C16H19F4NO3S/c1-10-9-21(14-4-2-3-13(17)15(14)24-10)25(22,23)12-7-5-11(6-8-12)16(18,19)20/h2-4,10-12H,5-9H2,1H3 |
| InChIKey | VAPPUPUZGOWAGJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-fluoro-2-methyl-4-[4-(trifluoromethyl)cyclohexyl]sulfonyl-2,3-dihydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-2-methyl-4-[4-(trifluoromethyl)cyclohexyl]sulfonyl-2,3-dihydro-1,4-benzoxazine?
The IUPAC name of 8-fluoro-2-methyl-4-[4-(trifluoromethyl)cyclohexyl]sulfonyl-2,3-dihydro-1,4-benzoxazine (CID 154744624) is 8-fluoro-2-methyl-4-[4-(trifluoromethyl)cyclohexyl]sulfonyl-2,3-dihydro-1,4-benzoxazine.
What is the SMILES notation for 8-fluoro-2-methyl-4-[4-(trifluoromethyl)cyclohexyl]sulfonyl-2,3-dihydro-1,4-benzoxazine?
The canonical SMILES for 8-fluoro-2-methyl-4-[4-(trifluoromethyl)cyclohexyl]sulfonyl-2,3-dihydro-1,4-benzoxazine is CC1CN(S(=O)(=O)C2CCC(C(F)(F)F)CC2)c2cccc(F)c2O1.
What is the InChIKey of 8-fluoro-2-methyl-4-[4-(trifluoromethyl)cyclohexyl]sulfonyl-2,3-dihydro-1,4-benzoxazine?
The InChIKey is VAPPUPUZGOWAGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F4NO3S/c1-10-9-21(14-4-2-3-13(17)15(14)24-10)25(22,23)12-7-5-11(6-8-12)16(18,19)20/h2-4,10-12H,5-9H2,1H3.
What are the key properties of 8-fluoro-2-methyl-4-[4-(trifluoromethyl)cyclohexyl]sulfonyl-2,3-dihydro-1,4-benzoxazine?
8-fluoro-2-methyl-4-[4-(trifluoromethyl)cyclohexyl]sulfonyl-2,3-dihydro-1,4-benzoxazine has a molecular weight of 381.39 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-2-methyl-4-[4-(trifluoromethyl)cyclohexyl]sulfonyl-2,3-dihydro-1,4-benzoxazine is sourced from PubChem (CID 154744624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).