C20H21N3O5 — CID 154745583
N-[3-(2-amino-2-oxoethoxy)phenyl]-1-(2-hydroxybenzoyl)pyrrolidine-2-carboxamide (PubChem CID 154745583) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is N-[3-(2-amino-2-oxoethoxy)phenyl]-1-(2-hydroxybenzoyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[3-(2-amino-2-oxoethoxy)phenyl]-1-(2-hydroxybenzoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 154745583 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[3-(2-amino-2-oxoethoxy)phenyl]-1-(2-hydroxybenzoyl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)COc1cccc(NC(=O)C2CCCN2C(=O)c2ccccc2O)c1 |
| InChI | InChI=1S/C20H21N3O5/c21-18(25)12-28-14-6-3-5-13(11-14)22-19(26)16-8-4-10-23(16)20(27)15-7-1-2-9-17(15)24/h1-3,5-7,9,11,16,24H,4,8,10,12H2,(H2,21,25)(H,22,26) |
| InChIKey | WLOJNPZJFVMAQN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |