About 4-[(7-benzyl-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]-5-methyl-1,2-oxazol-3-amine
4-[(7-benzyl-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]-5-methyl-1,2-oxazol-3-amine (PubChem CID 154745649) has the molecular formula C18H24N4O3S
and a molecular weight of 376.48 g/mol. Its IUPAC name is 4-[(7-benzyl-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]-5-methyl-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 4-[(7-benzyl-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]-5-methyl-1,2-oxazol-3-amine |
| PubChem CID | 154745649 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 4-[(7-benzyl-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]-5-methyl-1,2-oxazol-3-amine |
| SMILES | Cc1onc(N)c1S(=O)(=O)N1CCC2(CCN(Cc3ccccc3)C2)C1 |
| InChI | InChI=1S/C18H24N4O3S/c1-14-16(17(19)20-25-14)26(23,24)22-10-8-18(13-22)7-9-21(12-18)11-15-5-3-2-4-6-15/h2-6H,7-13H2,1H3,(H2,19,20) |
| InChIKey | UWCDZIKJLWBPAI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(7-benzyl-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]-5-methyl-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(7-benzyl-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]-5-methyl-1,2-oxazol-3-amine?
The IUPAC name of 4-[(7-benzyl-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]-5-methyl-1,2-oxazol-3-amine (CID 154745649) is 4-[(7-benzyl-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]-5-methyl-1,2-oxazol-3-amine.
What is the SMILES notation for 4-[(7-benzyl-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]-5-methyl-1,2-oxazol-3-amine?
The canonical SMILES for 4-[(7-benzyl-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]-5-methyl-1,2-oxazol-3-amine is Cc1onc(N)c1S(=O)(=O)N1CCC2(CCN(Cc3ccccc3)C2)C1.
What is the InChIKey of 4-[(7-benzyl-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]-5-methyl-1,2-oxazol-3-amine?
The InChIKey is UWCDZIKJLWBPAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O3S/c1-14-16(17(19)20-25-14)26(23,24)22-10-8-18(13-22)7-9-21(12-18)11-15-5-3-2-4-6-15/h2-6H,7-13H2,1H3,(H2,19,20).
What are the key properties of 4-[(7-benzyl-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]-5-methyl-1,2-oxazol-3-amine?
4-[(7-benzyl-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]-5-methyl-1,2-oxazol-3-amine has a molecular weight of 376.48 g/mol, XLogP of 1.85, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(7-benzyl-2,7-diazaspiro[4.4]nonan-2-yl)sulfonyl]-5-methyl-1,2-oxazol-3-amine is sourced from PubChem (CID 154745649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).