C18H22N2O5S — CID 154745673
1-[4-(cyclohex-3-en-1-ylmethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 154745673) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is 1-[4-(cyclohex-3-en-1-ylmethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1-[4-(cyclohex-3-en-1-ylmethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 154745673 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 1-[4-(cyclohex-3-en-1-ylmethylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CC(=O)N(c2ccc(S(=O)(=O)NCC3CC=CCC3)cc2)C1 |
| InChI | InChI=1S/C18H22N2O5S/c21-17-10-14(18(22)23)12-20(17)15-6-8-16(9-7-15)26(24,25)19-11-13-4-2-1-3-5-13/h1-2,6-9,13-14,19H,3-5,10-12H2,(H,22,23) |
| InChIKey | NLDKFJYCAUUNIM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|