About 2-(6,7-dichloro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxo-N-(thiadiazol-5-yl)acetamide
2-(6,7-dichloro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxo-N-(thiadiazol-5-yl)acetamide (PubChem CID 154745911) has the molecular formula C14H12Cl2N4O2S
and a molecular weight of 371.25 g/mol. Its IUPAC name is 2-(6,7-dichloro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxo-N-(thiadiazol-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-(6,7-dichloro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxo-N-(thiadiazol-5-yl)acetamide |
| PubChem CID | 154745911 |
| Molecular Formula | C14H12Cl2N4O2S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 2-(6,7-dichloro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxo-N-(thiadiazol-5-yl)acetamide |
| SMILES | CC1c2cc(Cl)c(Cl)cc2CCN1C(=O)C(=O)Nc1cnns1 |
| InChI | InChI=1S/C14H12Cl2N4O2S/c1-7-9-5-11(16)10(15)4-8(9)2-3-20(7)14(22)13(21)18-12-6-17-19-23-12/h4-7H,2-3H2,1H3,(H,18,21) |
| InChIKey | NMOYPLDSGHCCGG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(6,7-dichloro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxo-N-(thiadiazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,7-dichloro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxo-N-(thiadiazol-5-yl)acetamide?
The IUPAC name of 2-(6,7-dichloro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxo-N-(thiadiazol-5-yl)acetamide (CID 154745911) is 2-(6,7-dichloro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxo-N-(thiadiazol-5-yl)acetamide.
What is the SMILES notation for 2-(6,7-dichloro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxo-N-(thiadiazol-5-yl)acetamide?
The canonical SMILES for 2-(6,7-dichloro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxo-N-(thiadiazol-5-yl)acetamide is CC1c2cc(Cl)c(Cl)cc2CCN1C(=O)C(=O)Nc1cnns1.
What is the InChIKey of 2-(6,7-dichloro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxo-N-(thiadiazol-5-yl)acetamide?
The InChIKey is NMOYPLDSGHCCGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl2N4O2S/c1-7-9-5-11(16)10(15)4-8(9)2-3-20(7)14(22)13(21)18-12-6-17-19-23-12/h4-7H,2-3H2,1H3,(H,18,21).
What are the key properties of 2-(6,7-dichloro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxo-N-(thiadiazol-5-yl)acetamide?
2-(6,7-dichloro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxo-N-(thiadiazol-5-yl)acetamide has a molecular weight of 371.25 g/mol, XLogP of 2.93, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,7-dichloro-1-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxo-N-(thiadiazol-5-yl)acetamide is sourced from PubChem (CID 154745911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).