About 1-cyclopropyl-4-[[(3,4-difluorophenyl)methylamino]methyl]pyrrolidin-2-one
1-cyclopropyl-4-[[(3,4-difluorophenyl)methylamino]methyl]pyrrolidin-2-one (PubChem CID 154746765) has the molecular formula C15H18F2N2O
and a molecular weight of 280.32 g/mol. Its IUPAC name is 1-cyclopropyl-4-[[(3,4-difluorophenyl)methylamino]methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-cyclopropyl-4-[[(3,4-difluorophenyl)methylamino]methyl]pyrrolidin-2-one |
| PubChem CID | 154746765 |
| Molecular Formula | C15H18F2N2O |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 1-cyclopropyl-4-[[(3,4-difluorophenyl)methylamino]methyl]pyrrolidin-2-one |
| SMILES | O=C1CC(CNCc2ccc(F)c(F)c2)CN1C1CC1 |
| InChI | InChI=1S/C15H18F2N2O/c16-13-4-1-10(5-14(13)17)7-18-8-11-6-15(20)19(9-11)12-2-3-12/h1,4-5,11-12,18H,2-3,6-9H2 |
| InChIKey | NDDUCSMEAKBZEU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopropyl-4-[[(3,4-difluorophenyl)methylamino]methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-4-[[(3,4-difluorophenyl)methylamino]methyl]pyrrolidin-2-one?
The IUPAC name of 1-cyclopropyl-4-[[(3,4-difluorophenyl)methylamino]methyl]pyrrolidin-2-one (CID 154746765) is 1-cyclopropyl-4-[[(3,4-difluorophenyl)methylamino]methyl]pyrrolidin-2-one.
What is the SMILES notation for 1-cyclopropyl-4-[[(3,4-difluorophenyl)methylamino]methyl]pyrrolidin-2-one?
The canonical SMILES for 1-cyclopropyl-4-[[(3,4-difluorophenyl)methylamino]methyl]pyrrolidin-2-one is O=C1CC(CNCc2ccc(F)c(F)c2)CN1C1CC1.
What is the InChIKey of 1-cyclopropyl-4-[[(3,4-difluorophenyl)methylamino]methyl]pyrrolidin-2-one?
The InChIKey is NDDUCSMEAKBZEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F2N2O/c16-13-4-1-10(5-14(13)17)7-18-8-11-6-15(20)19(9-11)12-2-3-12/h1,4-5,11-12,18H,2-3,6-9H2.
What are the key properties of 1-cyclopropyl-4-[[(3,4-difluorophenyl)methylamino]methyl]pyrrolidin-2-one?
1-cyclopropyl-4-[[(3,4-difluorophenyl)methylamino]methyl]pyrrolidin-2-one has a molecular weight of 280.32 g/mol, XLogP of 2.07, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-4-[[(3,4-difluorophenyl)methylamino]methyl]pyrrolidin-2-one is sourced from PubChem (CID 154746765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).