C12H14BrNO4S — CID 154746789
2-(3-bromophenyl)-2-(1,1-dioxo-1,4-thiazinan-4-yl)acetic acid (PubChem CID 154746789) has the molecular formula C12H14BrNO4S and a molecular weight of 348.22 g/mol. Its IUPAC name is 2-(3-bromophenyl)-2-(1,1-dioxo-1,4-thiazinan-4-yl)acetic acid.
| Compound Name | 2-(3-bromophenyl)-2-(1,1-dioxo-1,4-thiazinan-4-yl)acetic acid |
|---|---|
| PubChem CID | 154746789 |
| Molecular Formula | C12H14BrNO4S |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 2-(3-bromophenyl)-2-(1,1-dioxo-1,4-thiazinan-4-yl)acetic acid |
| SMILES | O=C(O)C(c1cccc(Br)c1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H14BrNO4S/c13-10-3-1-2-9(8-10)11(12(15)16)14-4-6-19(17,18)7-5-14/h1-3,8,11H,4-7H2,(H,15,16) |
| InChIKey | RQXYOKJDDRNGEL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |