C19H24FN5 — CID 154747934
4-[[4-[(1-ethylimidazol-2-yl)methyl]-3-methylpiperazin-1-yl]methyl]-3-fluorobenzonitrile (PubChem CID 154747934) has the molecular formula C19H24FN5 and a molecular weight of 341.43 g/mol. Its IUPAC name is 4-[[4-[(1-ethylimidazol-2-yl)methyl]-3-methylpiperazin-1-yl]methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[[4-[(1-ethylimidazol-2-yl)methyl]-3-methylpiperazin-1-yl]methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 154747934 |
| Molecular Formula | C19H24FN5 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 4-[[4-[(1-ethylimidazol-2-yl)methyl]-3-methylpiperazin-1-yl]methyl]-3-fluorobenzonitrile |
| SMILES | CCn1ccnc1CN1CCN(Cc2ccc(C#N)cc2F)CC1C |
| InChI | InChI=1S/C19H24FN5/c1-3-24-7-6-22-19(24)14-25-9-8-23(12-15(25)2)13-17-5-4-16(11-21)10-18(17)20/h4-7,10,15H,3,8-9,12-14H2,1-2H3 |
| InChIKey | UYICIKDEANOBDN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 48.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |