C17H31N3O4 — CID 154748134
1-[3-[4-(3-ethoxy-2-hydroxypropyl)piperazine-1-carbonyl]piperidin-1-yl]ethanone (PubChem CID 154748134) has the molecular formula C17H31N3O4 and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-[3-[4-(3-ethoxy-2-hydroxypropyl)piperazine-1-carbonyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[3-[4-(3-ethoxy-2-hydroxypropyl)piperazine-1-carbonyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 154748134 |
| Molecular Formula | C17H31N3O4 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | 1-[3-[4-(3-ethoxy-2-hydroxypropyl)piperazine-1-carbonyl]piperidin-1-yl]ethanone |
| SMILES | CCOCC(O)CN1CCN(C(=O)C2CCCN(C(C)=O)C2)CC1 |
| InChI | InChI=1S/C17H31N3O4/c1-3-24-13-16(22)12-18-7-9-19(10-8-18)17(23)15-5-4-6-20(11-15)14(2)21/h15-16,22H,3-13H2,1-2H3 |
| InChIKey | WHWPSTSJKAIAGS-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |